(E)-2-(dimethylamino)ethenesulfonyl fluoride

C4H8FNO2S — CID 15065623

IUPAC(E)-2-(dimethylamino)ethenesulfonyl fluoride
SMILESCN(C)/C=C/S(=O)(=O)F
InChIInChI=1S/C4H8FNO2S/c1-6(2)3-4-9(5,7)8/h3-4H,1-2H3/b4-3+
InChIKeyFZLCHGBQIHLEBY-ONEGZZNKSA-N
MW153.18 g/mol
LogP0.32
Rot. Bonds2

About (E)-2-(dimethylamino)ethenesulfonyl fluoride

(E)-2-(dimethylamino)ethenesulfonyl fluoride (PubChem CID 15065623) has the molecular formula C4H8FNO2S and a molecular weight of 153.18 g/mol. Its IUPAC name is (E)-2-(dimethylamino)ethenesulfonyl fluoride.

Molecular Properties

Compound Name(E)-2-(dimethylamino)ethenesulfonyl fluoride
PubChem CID15065623
Molecular FormulaC4H8FNO2S
Molecular Weight153.18 g/mol
Exact Mass153.03
IUPAC Name(E)-2-(dimethylamino)ethenesulfonyl fluoride
SMILESCN(C)/C=C/S(=O)(=O)F
InChIInChI=1S/C4H8FNO2S/c1-6(2)3-4-9(5,7)8/h3-4H,1-2H3/b4-3+
InChIKeyFZLCHGBQIHLEBY-ONEGZZNKSA-N
XLogP0.32
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.18
LogP ≤ 50.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (E)-2-(dimethylamino)ethenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2-(dimethylamino)ethenesulfonyl fluoride?
The IUPAC name of (E)-2-(dimethylamino)ethenesulfonyl fluoride (CID 15065623) is (E)-2-(dimethylamino)ethenesulfonyl fluoride.
What is the SMILES notation for (E)-2-(dimethylamino)ethenesulfonyl fluoride?
The canonical SMILES for (E)-2-(dimethylamino)ethenesulfonyl fluoride is CN(C)/C=C/S(=O)(=O)F.
What is the InChIKey of (E)-2-(dimethylamino)ethenesulfonyl fluoride?
The InChIKey is FZLCHGBQIHLEBY-ONEGZZNKSA-N. The full InChI is InChI=1S/C4H8FNO2S/c1-6(2)3-4-9(5,7)8/h3-4H,1-2H3/b4-3+.
What are the key properties of (E)-2-(dimethylamino)ethenesulfonyl fluoride?
(E)-2-(dimethylamino)ethenesulfonyl fluoride has a molecular weight of 153.18 g/mol, XLogP of 0.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(dimethylamino)ethenesulfonyl fluoride is sourced from PubChem (CID 15065623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).