C14H12Cl3F3O4 — CID 150657261
6,7,7-trichloro-8-propoxy-2-(trifluoromethyl)-2,3-dihydrochromene-3-carboxylic acid (PubChem CID 150657261) has the molecular formula C14H12Cl3F3O4 and a molecular weight of 407.60 g/mol. Its IUPAC name is 6,7,7-trichloro-8-propoxy-2-(trifluoromethyl)-2,3-dihydrochromene-3-carboxylic acid.
| Compound Name | 6,7,7-trichloro-8-propoxy-2-(trifluoromethyl)-2,3-dihydrochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 150657261 |
| Molecular Formula | C14H12Cl3F3O4 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 6,7,7-trichloro-8-propoxy-2-(trifluoromethyl)-2,3-dihydrochromene-3-carboxylic acid |
| SMILES | CCCOC1=C2OC(C(F)(F)F)C(C(=O)O)C=C2C=C(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C14H12Cl3F3O4/c1-2-3-23-11-9-6(5-8(15)13(11,16)17)4-7(12(21)22)10(24-9)14(18,19)20/h4-5,7,10H,2-3H2,1H3,(H,21,22) |
| InChIKey | JDCRGAULLPXUSQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|