C24H30BrF3N4O2Si — CID 150658279
cis-(1R,2S)-2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentan-1-ol (PubChem CID 150658279) has the molecular formula C24H30BrF3N4O2Si and a molecular weight of 571.51 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentan-1-ol.
| Compound Name | cis-(1R,2S)-2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 150658279 |
| Molecular Formula | C24H30BrF3N4O2Si |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | cis-(1R,2S)-2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentan-1-ol |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2nc(N[C@H]3CCC[C@H]3O)ncc2C(F)(F)F)c2ccc(Br)cc21 |
| InChI | InChI=1S/C24H30BrF3N4O2Si/c1-35(2,3)10-9-34-14-32-13-17(16-8-7-15(25)11-20(16)32)22-18(24(26,27)28)12-29-23(31-22)30-19-5-4-6-21(19)33/h7-8,11-13,19,21,33H,4-6,9-10,14H2,1-3H3,(H,29,30,31)/t19-,21+/m0/s1 |
| InChIKey | JDHVRUSVWHXOGK-PZJWPPBQSA-N |
| XLogP | 6.52 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|