C12H16N2O3 — CID 15065992
1,3-bis(2-methylprop-2-enyl)-1,3-diazinane-2,4,6-trione (PubChem CID 15065992) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1,3-bis(2-methylprop-2-enyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-bis(2-methylprop-2-enyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15065992 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1,3-bis(2-methylprop-2-enyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=C(C)CN1C(=O)CC(=O)N(CC(=C)C)C1=O |
| InChI | InChI=1S/C12H16N2O3/c1-8(2)6-13-10(15)5-11(16)14(12(13)17)7-9(3)4/h1,3,5-7H2,2,4H3 |
| InChIKey | SLASLCSEXUWCFO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|