C9H14O4 — CID 150660473
1,3-dioxacycloundecane-2,5-dione (PubChem CID 150660473) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1,3-dioxacycloundecane-2,5-dione.
| Compound Name | 1,3-dioxacycloundecane-2,5-dione |
|---|---|
| PubChem CID | 150660473 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1,3-dioxacycloundecane-2,5-dione |
| SMILES | O=C1CCCCCCOC(=O)OC1 |
| InChI | InChI=1S/C9H14O4/c10-8-5-3-1-2-4-6-12-9(11)13-7-8/h1-7H2 |
| InChIKey | JDUBYNYKMAREAK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |