About 1,3-dioxacycloundecane-2,5-dione
1,3-dioxacycloundecane-2,5-dione (PubChem CID 150660473) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 1,3-dioxacycloundecane-2,5-dione.
Molecular Properties
| Compound Name | 1,3-dioxacycloundecane-2,5-dione |
| PubChem CID | 150660473 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1,3-dioxacycloundecane-2,5-dione |
| SMILES | O=C1CCCCCCOC(=O)OC1 |
| InChI | InChI=1S/C9H14O4/c10-8-5-3-1-2-4-6-12-9(11)13-7-8/h1-7H2 |
| InChIKey | JDUBYNYKMAREAK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dioxacycloundecane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxacycloundecane-2,5-dione?
The IUPAC name of 1,3-dioxacycloundecane-2,5-dione (CID 150660473) is 1,3-dioxacycloundecane-2,5-dione.
What is the SMILES notation for 1,3-dioxacycloundecane-2,5-dione?
The canonical SMILES for 1,3-dioxacycloundecane-2,5-dione is O=C1CCCCCCOC(=O)OC1.
What is the InChIKey of 1,3-dioxacycloundecane-2,5-dione?
The InChIKey is JDUBYNYKMAREAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c10-8-5-3-1-2-4-6-12-9(11)13-7-8/h1-7H2.
What are the key properties of 1,3-dioxacycloundecane-2,5-dione?
1,3-dioxacycloundecane-2,5-dione has a molecular weight of 186.21 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxacycloundecane-2,5-dione is sourced from PubChem (CID 150660473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).