About 2-hydrazinyloctanedioic acid
2-hydrazinyloctanedioic acid (PubChem CID 150661126) has the molecular formula C8H16N2O4
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-hydrazinyloctanedioic acid.
Molecular Properties
| Compound Name | 2-hydrazinyloctanedioic acid |
| PubChem CID | 150661126 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-hydrazinyloctanedioic acid |
| SMILES | NNC(CCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N2O4/c9-10-6(8(13)14)4-2-1-3-5-7(11)12/h6,10H,1-5,9H2,(H,11,12)(H,13,14) |
| InChIKey | JDXDAJXKOXUAMO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinyloctanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinyloctanedioic acid?
The IUPAC name of 2-hydrazinyloctanedioic acid (CID 150661126) is 2-hydrazinyloctanedioic acid.
What is the SMILES notation for 2-hydrazinyloctanedioic acid?
The canonical SMILES for 2-hydrazinyloctanedioic acid is NNC(CCCCCC(=O)O)C(=O)O.
What is the InChIKey of 2-hydrazinyloctanedioic acid?
The InChIKey is JDXDAJXKOXUAMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O4/c9-10-6(8(13)14)4-2-1-3-5-7(11)12/h6,10H,1-5,9H2,(H,11,12)(H,13,14).
What are the key properties of 2-hydrazinyloctanedioic acid?
2-hydrazinyloctanedioic acid has a molecular weight of 204.23 g/mol, XLogP of -0.06, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinyloctanedioic acid is sourced from PubChem (CID 150661126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).