2-hydrazinyloctanedioic acid

C8H16N2O4 — CID 150661126

IUPAC2-hydrazinyloctanedioic acid
SMILESNNC(CCCCCC(=O)O)C(=O)O
InChIInChI=1S/C8H16N2O4/c9-10-6(8(13)14)4-2-1-3-5-7(11)12/h6,10H,1-5,9H2,(H,11,12)(H,13,14)
InChIKeyJDXDAJXKOXUAMO-UHFFFAOYSA-N
MW204.23 g/mol
LogP-0.06
Rot. Bonds8

About 2-hydrazinyloctanedioic acid

2-hydrazinyloctanedioic acid (PubChem CID 150661126) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-hydrazinyloctanedioic acid.

Molecular Properties

Compound Name2-hydrazinyloctanedioic acid
PubChem CID150661126
Molecular FormulaC8H16N2O4
Molecular Weight204.23 g/mol
Exact Mass204.11
IUPAC Name2-hydrazinyloctanedioic acid
SMILESNNC(CCCCCC(=O)O)C(=O)O
InChIInChI=1S/C8H16N2O4/c9-10-6(8(13)14)4-2-1-3-5-7(11)12/h6,10H,1-5,9H2,(H,11,12)(H,13,14)
InChIKeyJDXDAJXKOXUAMO-UHFFFAOYSA-N
XLogP-0.06
TPSA112.65 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.23
LogP ≤ 5-0.06
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-hydrazinyloctanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

20-[[(5S)-5-carboxy-5-hydrazinylpentyl]amino]-20-oxoicosanoic acid
CID 118266936
(2S)-2-hydrazinylheptanoic acid
CID 118266927
2-methylhenicosanedioic acid
CID 21286141
18-[[(1S)-5-amino-1-carboxypentyl]amino]-18-oxooctadecanoic acid
CID 177296826
2-(6-aminohexylamino)decanedioic acid
CID 140815288
19-methoxy-18-methyl-19-oxononadecanoic acid
CID 89462442
6,12-diaminoheptadecanedioic acid
CID 23455605
8-[(4-amino-1-carboxybutyl)amino]-8-oxooctanoic acid
CID 118550134
8-[[(1S)-4-amino-1-carboxybutyl]amino]-8-oxooctanoic acid
CID 118550149
(2S)-6-amino-2-(4-carboxybutylamino)hexanoic acid
CID 164521049
(2S)-2-(6-carboxyhexylamino)decanoic acid
CID 124673847
hexadecane-1,6,7,16-tetracarboxylic acid
CID 90941074

Frequently Asked Questions

What is the IUPAC name of 2-hydrazinyloctanedioic acid?
The IUPAC name of 2-hydrazinyloctanedioic acid (CID 150661126) is 2-hydrazinyloctanedioic acid.
What is the SMILES notation for 2-hydrazinyloctanedioic acid?
The canonical SMILES for 2-hydrazinyloctanedioic acid is NNC(CCCCCC(=O)O)C(=O)O.
What is the InChIKey of 2-hydrazinyloctanedioic acid?
The InChIKey is JDXDAJXKOXUAMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O4/c9-10-6(8(13)14)4-2-1-3-5-7(11)12/h6,10H,1-5,9H2,(H,11,12)(H,13,14).
What are the key properties of 2-hydrazinyloctanedioic acid?
2-hydrazinyloctanedioic acid has a molecular weight of 204.23 g/mol, XLogP of -0.06, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinyloctanedioic acid is sourced from PubChem (CID 150661126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).