C21H39N7 — CID 15066137
2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 15066137) has the molecular formula C21H39N7 and a molecular weight of 389.59 g/mol. Its IUPAC name is 2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 15066137 |
| Molecular Formula | C21H39N7 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.33 |
| IUPAC Name | 2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)CC(Nc2ncnc(NC3CC(C)(C)NC(C)(C)C3)n2)CC(C)(C)N1 |
| InChI | InChI=1S/C21H39N7/c1-18(2)9-14(10-19(3,4)27-18)24-16-22-13-23-17(26-16)25-15-11-20(5,6)28-21(7,8)12-15/h13-15,27-28H,9-12H2,1-8H3,(H2,22,23,24,25,26) |
| InChIKey | JYGOUUQSMBQTPY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |