C30H62N4 — CID 15066273
N,N'-bis[1-(2,2,6,6-tetramethylpiperidin-4-yl)propan-2-yl]hexane-1,6-diamine (PubChem CID 15066273) has the molecular formula C30H62N4 and a molecular weight of 478.85 g/mol. Its IUPAC name is N,N'-bis[1-(2,2,6,6-tetramethylpiperidin-4-yl)propan-2-yl]hexane-1,6-diamine.
| Compound Name | N,N'-bis[1-(2,2,6,6-tetramethylpiperidin-4-yl)propan-2-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 15066273 |
| Molecular Formula | C30H62N4 |
| Molecular Weight | 478.85 g/mol |
| Exact Mass | 478.50 |
| IUPAC Name | N,N'-bis[1-(2,2,6,6-tetramethylpiperidin-4-yl)propan-2-yl]hexane-1,6-diamine |
| SMILES | CC(CC1CC(C)(C)NC(C)(C)C1)NCCCCCCNC(C)CC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C30H62N4/c1-23(17-25-19-27(3,4)33-28(5,6)20-25)31-15-13-11-12-14-16-32-24(2)18-26-21-29(7,8)34-30(9,10)22-26/h23-26,31-34H,11-22H2,1-10H3 |
| InChIKey | IEGNMUBUSJCTIX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.85 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|