C11H21F3O2Si — CID 150663036
[tert-butyl(dimethyl)silyl] 3,3,3-trifluoro-2,2-dimethylpropanoate (PubChem CID 150663036) has the molecular formula C11H21F3O2Si and a molecular weight of 270.37 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 3,3,3-trifluoro-2,2-dimethylpropanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 3,3,3-trifluoro-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 150663036 |
| Molecular Formula | C11H21F3O2Si |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 3,3,3-trifluoro-2,2-dimethylpropanoate |
| SMILES | CC(C)(C(=O)O[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H21F3O2Si/c1-9(2,3)17(6,7)16-8(15)10(4,5)11(12,13)14/h1-7H3 |
| InChIKey | JEGYRUZIAXUBIM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|