About 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione
6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione (PubChem CID 15066340) has the molecular formula C12H6BrN3O4
and a molecular weight of 336.10 g/mol. Its IUPAC name is 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione.
Molecular Properties
| Compound Name | 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione |
| PubChem CID | 15066340 |
| Molecular Formula | C12H6BrN3O4 |
| Molecular Weight | 336.10 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc(Br)c3cccc([N+](=O)[O-])c3c2[nH]c1=O |
| InChI | InChI=1S/C12H6BrN3O4/c13-6-4-7-10(15-12(18)11(17)14-7)9-5(6)2-1-3-8(9)16(19)20/h1-4H,(H,14,17)(H,15,18) |
| InChIKey | QOFBNPPNHMIVRZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.10 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione?
The IUPAC name of 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione (CID 15066340) is 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione.
What is the SMILES notation for 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione?
The canonical SMILES for 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione is O=c1[nH]c2cc(Br)c3cccc([N+](=O)[O-])c3c2[nH]c1=O.
What is the InChIKey of 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione?
The InChIKey is QOFBNPPNHMIVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6BrN3O4/c13-6-4-7-10(15-12(18)11(17)14-7)9-5(6)2-1-3-8(9)16(19)20/h1-4H,(H,14,17)(H,15,18).
What are the key properties of 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione?
6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione has a molecular weight of 336.10 g/mol, XLogP of 2.04, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-10-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione is sourced from PubChem (CID 15066340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).