C20H41N3O — CID 150663725
N-[4-[di(propan-2-yl)amino]butyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide (PubChem CID 150663725) has the molecular formula C20H41N3O and a molecular weight of 339.57 g/mol. Its IUPAC name is N-[4-[di(propan-2-yl)amino]butyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide.
| Compound Name | N-[4-[di(propan-2-yl)amino]butyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 150663725 |
| Molecular Formula | C20H41N3O |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.32 |
| IUPAC Name | N-[4-[di(propan-2-yl)amino]butyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
| SMILES | CC(C)N(CCCCN(C=O)C1CC(C)(C)NC(C)(C)C1)C(C)C |
| InChI | InChI=1S/C20H41N3O/c1-16(2)23(17(3)4)12-10-9-11-22(15-24)18-13-19(5,6)21-20(7,8)14-18/h15-18,21H,9-14H2,1-8H3 |
| InChIKey | JEKMOAXZGWDBMY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|