C10H14N2O2 — CID 150666174
3-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-2-one (PubChem CID 150666174) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-2-one.
| Compound Name | 3-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 150666174 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-2-one |
| SMILES | Cc1cc(CC2CCCNC2=O)no1 |
| InChI | InChI=1S/C10H14N2O2/c1-7-5-9(12-14-7)6-8-3-2-4-11-10(8)13/h5,8H,2-4,6H2,1H3,(H,11,13) |
| InChIKey | JEXMDWQTYDZKFG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |