(3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate

C11H11F3O5S — CID 150668638

IUPAC(3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate
SMILESO=C1CCC2(CC=C(OS(=O)(=O)C(F)(F)F)CC2)C1=O
InChIInChI=1S/C11H11F3O5S/c12-11(13,14)20(17,18)19-7-1-4-10(5-2-7)6-3-8(15)9(10)16/h1H,2-6H2
InChIKeyJFKJXOYHHFKNSG-UHFFFAOYSA-N
MW312.27 g/mol
LogP1.84
Rot. Bonds2

About (3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate

(3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate (PubChem CID 150668638) has the molecular formula C11H11F3O5S and a molecular weight of 312.27 g/mol. Its IUPAC name is (3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate.

Molecular Properties

Compound Name(3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate
PubChem CID150668638
Molecular FormulaC11H11F3O5S
Molecular Weight312.27 g/mol
Exact Mass312.03
IUPAC Name(3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate
SMILESO=C1CCC2(CC=C(OS(=O)(=O)C(F)(F)F)CC2)C1=O
InChIInChI=1S/C11H11F3O5S/c12-11(13,14)20(17,18)19-7-1-4-10(5-2-7)6-3-8(15)9(10)16/h1H,2-6H2
InChIKeyJFKJXOYHHFKNSG-UHFFFAOYSA-N
XLogP1.84
TPSA77.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.27
LogP ≤ 51.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}

Analyze (3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate?
The IUPAC name of (3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate (CID 150668638) is (3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate.
What is the SMILES notation for (3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate?
The canonical SMILES for (3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate is O=C1CCC2(CC=C(OS(=O)(=O)C(F)(F)F)CC2)C1=O.
What is the InChIKey of (3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate?
The InChIKey is JFKJXOYHHFKNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3O5S/c12-11(13,14)20(17,18)19-7-1-4-10(5-2-7)6-3-8(15)9(10)16/h1H,2-6H2.
What are the key properties of (3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate?
(3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate has a molecular weight of 312.27 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dioxospiro[4.5]dec-8-en-8-yl) trifluoromethanesulfonate is sourced from PubChem (CID 150668638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).