C15H14N2O4 — CID 15066874
3,4-dimethyl-7-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one (PubChem CID 15066874) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3,4-dimethyl-7-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one.
| Compound Name | 3,4-dimethyl-7-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 15066874 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3,4-dimethyl-7-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one |
| SMILES | Cc1nnc(COc2ccc3c(C)c(C)c(=O)oc3c2)o1 |
| InChI | InChI=1S/C15H14N2O4/c1-8-9(2)15(18)21-13-6-11(4-5-12(8)13)19-7-14-17-16-10(3)20-14/h4-6H,7H2,1-3H3 |
| InChIKey | HAZCKGIPEIZFCN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|