C16H16N2O4 — CID 15066880
7-[(5-ethyl-1,3,4-oxadiazol-2-yl)methoxy]-3,4-dimethylchromen-2-one (PubChem CID 15066880) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 7-[(5-ethyl-1,3,4-oxadiazol-2-yl)methoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[(5-ethyl-1,3,4-oxadiazol-2-yl)methoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 15066880 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 7-[(5-ethyl-1,3,4-oxadiazol-2-yl)methoxy]-3,4-dimethylchromen-2-one |
| SMILES | CCc1nnc(COc2ccc3c(C)c(C)c(=O)oc3c2)o1 |
| InChI | InChI=1S/C16H16N2O4/c1-4-14-17-18-15(22-14)8-20-11-5-6-12-9(2)10(3)16(19)21-13(12)7-11/h5-7H,4,8H2,1-3H3 |
| InChIKey | PGAVTNZEUUPMET-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|