About 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one
3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one (PubChem CID 15066886) has the molecular formula C14H12N2O3S
and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one.
Molecular Properties
| Compound Name | 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one |
| PubChem CID | 15066886 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one |
| SMILES | Cc1nnc(COc2ccc3cc(C)c(=O)oc3c2)s1 |
| InChI | InChI=1S/C14H12N2O3S/c1-8-5-10-3-4-11(6-12(10)19-14(8)17)18-7-13-16-15-9(2)20-13/h3-6H,7H2,1-2H3 |
| InChIKey | AIDIXDSWDCDRTF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one?
The IUPAC name of 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one (CID 15066886) is 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one.
What is the SMILES notation for 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one?
The canonical SMILES for 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one is Cc1nnc(COc2ccc3cc(C)c(=O)oc3c2)s1.
What is the InChIKey of 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one?
The InChIKey is AIDIXDSWDCDRTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3S/c1-8-5-10-3-4-11(6-12(10)19-14(8)17)18-7-13-16-15-9(2)20-13/h3-6H,7H2,1-2H3.
What are the key properties of 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one?
3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one has a molecular weight of 288.33 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7-[(5-methyl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one is sourced from PubChem (CID 15066886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).