C21H15F6NO — CID 150670036
2-[2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]phenoxy]aniline (PubChem CID 150670036) has the molecular formula C21H15F6NO and a molecular weight of 411.35 g/mol. Its IUPAC name is 2-[2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]phenoxy]aniline.
| Compound Name | 2-[2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]phenoxy]aniline |
|---|---|
| PubChem CID | 150670036 |
| Molecular Formula | C21H15F6NO |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-[2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]phenoxy]aniline |
| SMILES | Nc1ccccc1Oc1ccccc1-c1ccccc1C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H15F6NO/c22-20(23,24)19(21(25,26)27)15-9-2-1-7-13(15)14-8-3-5-11-17(14)29-18-12-6-4-10-16(18)28/h1-12,19H,28H2 |
| InChIKey | JFRNSGLDDWKXOZ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|