C19H38O6Si — CID 150670600
ethenyl-diethoxy-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane (PubChem CID 150670600) has the molecular formula C19H38O6Si and a molecular weight of 390.59 g/mol. Its IUPAC name is ethenyl-diethoxy-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane.
| Compound Name | ethenyl-diethoxy-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane |
|---|---|
| PubChem CID | 150670600 |
| Molecular Formula | C19H38O6Si |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | ethenyl-diethoxy-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane |
| SMILES | C=CC(O[Si](C=C)(OCC)OCC)C(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C19H38O6Si/c1-11-18(25-26(14-4,20-12-2)21-13-3)19(22-15(5)6,23-16(7)8)24-17(9)10/h11,14-18H,1,4,12-13H2,2-3,5-10H3 |
| InChIKey | JFUIZCAJRUKKSW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|