C32H38O2Si — CID 15067574
(2E,4E)-5-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]phenyl]penta-2,4-dienal (PubChem CID 15067574) has the molecular formula C32H38O2Si and a molecular weight of 482.74 g/mol. Its IUPAC name is (2E,4E)-5-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]phenyl]penta-2,4-dienal.
| Compound Name | (2E,4E)-5-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]phenyl]penta-2,4-dienal |
|---|---|
| PubChem CID | 15067574 |
| Molecular Formula | C32H38O2Si |
| Molecular Weight | 482.74 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | (2E,4E)-5-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]phenyl]penta-2,4-dienal |
| SMILES | CC(C)(C)[Si](OCCCCCc1ccccc1/C=C/C=C/C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38O2Si/c1-32(2,3)35(30-22-10-4-11-23-30,31-24-12-5-13-25-31)34-27-17-7-9-19-29-21-15-14-20-28(29)18-8-6-16-26-33/h4-6,8,10-16,18,20-26H,7,9,17,19,27H2,1-3H3/b16-6+,18-8+ |
| InChIKey | QKLSUTXEAINXEA-NCGXIBSESA-N |
| XLogP | 6.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.74 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|