C8H15F3O4 — CID 150679789
8,8,8-trifluorooctane-1,1,1,2-tetrol (PubChem CID 150679789) has the molecular formula C8H15F3O4 and a molecular weight of 232.20 g/mol. Its IUPAC name is 8,8,8-trifluorooctane-1,1,1,2-tetrol.
| Compound Name | 8,8,8-trifluorooctane-1,1,1,2-tetrol |
|---|---|
| PubChem CID | 150679789 |
| Molecular Formula | C8H15F3O4 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 8,8,8-trifluorooctane-1,1,1,2-tetrol |
| SMILES | OC(CCCCCC(F)(F)F)C(O)(O)O |
| InChI | InChI=1S/C8H15F3O4/c9-7(10,11)5-3-1-2-4-6(12)8(13,14)15/h6,12-15H,1-5H2 |
| InChIKey | JHPYWFOQNNSTRW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|