About 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate
6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate (PubChem CID 150682400) has the molecular formula C10H9F3NO3-
and a molecular weight of 248.18 g/mol. Its IUPAC name is 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate |
| PubChem CID | 150682400 |
| Molecular Formula | C10H9F3NO3- |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate |
| SMILES | O=C([O-])c1ccc(COCCC(F)(F)F)nc1 |
| InChI | InChI=1S/C10H10F3NO3/c11-10(12,13)3-4-17-6-8-2-1-7(5-14-8)9(15)16/h1-2,5H,3-4,6H2,(H,15,16)/p-1 |
| InChIKey | JIDNOITZTWPCDQ-UHFFFAOYSA-M |
| XLogP | 0.91 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate?
The IUPAC name of 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate (CID 150682400) is 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate.
What is the SMILES notation for 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate?
The canonical SMILES for 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate is O=C([O-])c1ccc(COCCC(F)(F)F)nc1.
What is the InChIKey of 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate?
The InChIKey is JIDNOITZTWPCDQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10F3NO3/c11-10(12,13)3-4-17-6-8-2-1-7(5-14-8)9(15)16/h1-2,5H,3-4,6H2,(H,15,16)/p-1.
What are the key properties of 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate?
6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate has a molecular weight of 248.18 g/mol, XLogP of 0.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,3,3-trifluoropropoxymethyl)pyridine-3-carboxylate is sourced from PubChem (CID 150682400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).