About 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol
1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol (PubChem CID 150684067) has the molecular formula C16H22N2O
and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol |
| PubChem CID | 150684067 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol |
| SMILES | Cc1cc(C(O)CC(C)(C)C)cc(-n2ccnc2)c1 |
| InChI | InChI=1S/C16H22N2O/c1-12-7-13(15(19)10-16(2,3)4)9-14(8-12)18-6-5-17-11-18/h5-9,11,15,19H,10H2,1-4H3 |
| InChIKey | JIMAREFVJNGJSE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol?
The IUPAC name of 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol (CID 150684067) is 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol.
What is the SMILES notation for 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol?
The canonical SMILES for 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol is Cc1cc(C(O)CC(C)(C)C)cc(-n2ccnc2)c1.
What is the InChIKey of 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol?
The InChIKey is JIMAREFVJNGJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O/c1-12-7-13(15(19)10-16(2,3)4)9-14(8-12)18-6-5-17-11-18/h5-9,11,15,19H,10H2,1-4H3.
What are the key properties of 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol?
1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol has a molecular weight of 258.36 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-imidazol-1-yl-5-methylphenyl)-3,3-dimethylbutan-1-ol is sourced from PubChem (CID 150684067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).