C18H16Cl4N2O4S — CID 150684893
2,2,2-trichloroethyl 3-(chloromethyl)-2-[7-oxo-3-(phenoxymethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoate (PubChem CID 150684893) has the molecular formula C18H16Cl4N2O4S and a molecular weight of 498.22 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 3-(chloromethyl)-2-[7-oxo-3-(phenoxymethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoate.
| Compound Name | 2,2,2-trichloroethyl 3-(chloromethyl)-2-[7-oxo-3-(phenoxymethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoate |
|---|---|
| PubChem CID | 150684893 |
| Molecular Formula | C18H16Cl4N2O4S |
| Molecular Weight | 498.22 g/mol |
| Exact Mass | 495.96 |
| IUPAC Name | 2,2,2-trichloroethyl 3-(chloromethyl)-2-[7-oxo-3-(phenoxymethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoate |
| SMILES | C=C(CCl)C(C(=O)OCC(Cl)(Cl)Cl)N1C(=O)C2N=C(COc3ccccc3)SC21 |
| InChI | InChI=1S/C18H16Cl4N2O4S/c1-10(7-19)14(17(26)28-9-18(20,21)22)24-15(25)13-16(24)29-12(23-13)8-27-11-5-3-2-4-6-11/h2-6,13-14,16H,1,7-9H2 |
| InChIKey | JIQLHCXXNZVNIU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|