C19H18ClFN4O — CID 150685156
1-[(1S)-1-(1-aminoisoquinolin-4-yl)ethyl]-3-(3-chloro-2-fluorophenyl)-1-methylurea (PubChem CID 150685156) has the molecular formula C19H18ClFN4O and a molecular weight of 372.83 g/mol. Its IUPAC name is 1-[(1S)-1-(1-aminoisoquinolin-4-yl)ethyl]-3-(3-chloro-2-fluorophenyl)-1-methylurea.
| Compound Name | 1-[(1S)-1-(1-aminoisoquinolin-4-yl)ethyl]-3-(3-chloro-2-fluorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 150685156 |
| Molecular Formula | C19H18ClFN4O |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-[(1S)-1-(1-aminoisoquinolin-4-yl)ethyl]-3-(3-chloro-2-fluorophenyl)-1-methylurea |
| SMILES | C[C@@H](c1cnc(N)c2ccccc12)N(C)C(=O)Nc1cccc(Cl)c1F |
| InChI | InChI=1S/C19H18ClFN4O/c1-11(14-10-23-18(22)13-7-4-3-6-12(13)14)25(2)19(26)24-16-9-5-8-15(20)17(16)21/h3-11H,1-2H3,(H2,22,23)(H,24,26)/t11-/m0/s1 |
| InChIKey | JIRWXTWZBNXMMC-NSHDSACASA-N |
| XLogP | 4.83 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |