About 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate
2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate (PubChem CID 15068516) has the molecular formula C13H19ClN4O3
and a molecular weight of 314.77 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate |
| PubChem CID | 15068516 |
| Molecular Formula | C13H19ClN4O3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate |
| SMILES | COCCOCCO/C(N)=N/C(N)=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H19ClN4O3/c1-19-6-7-20-8-9-21-13(16)18-12(15)17-11-4-2-10(14)3-5-11/h2-5H,6-9H2,1H3,(H4,15,16,17,18) |
| InChIKey | FOGBKUKAMVREEP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate?
The IUPAC name of 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate (CID 15068516) is 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate.
What is the SMILES notation for 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate?
The canonical SMILES for 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate is COCCOCCO/C(N)=N/C(N)=N/c1ccc(Cl)cc1.
What is the InChIKey of 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate?
The InChIKey is FOGBKUKAMVREEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClN4O3/c1-19-6-7-20-8-9-21-13(16)18-12(15)17-11-4-2-10(14)3-5-11/h2-5H,6-9H2,1H3,(H4,15,16,17,18).
What are the key properties of 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate?
2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate has a molecular weight of 314.77 g/mol, XLogP of 1.28, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)ethyl N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidate is sourced from PubChem (CID 15068516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).