C14H19BrN6O — CID 15068541
2-bromo-N-[[3-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenyl]methyl]acetamide (PubChem CID 15068541) has the molecular formula C14H19BrN6O and a molecular weight of 367.25 g/mol. Its IUPAC name is 2-bromo-N-[[3-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenyl]methyl]acetamide.
| Compound Name | 2-bromo-N-[[3-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 15068541 |
| Molecular Formula | C14H19BrN6O |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-bromo-N-[[3-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenyl]methyl]acetamide |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1cccc(CNC(=O)CBr)c1 |
| InChI | InChI=1S/C14H19BrN6O/c1-14(2)20-12(16)19-13(17)21(14)10-5-3-4-9(6-10)8-18-11(22)7-15/h3-6H,7-8H2,1-2H3,(H,18,22)(H4,16,17,19,20) |
| InChIKey | IUJFHSUDVOZPJP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|