C21H25BrN6O — CID 15068554
2-bromo-N-[4-[2-[3-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenyl]ethyl]phenyl]acetamide (PubChem CID 15068554) has the molecular formula C21H25BrN6O and a molecular weight of 457.38 g/mol. Its IUPAC name is 2-bromo-N-[4-[2-[3-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenyl]ethyl]phenyl]acetamide.
| Compound Name | 2-bromo-N-[4-[2-[3-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenyl]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 15068554 |
| Molecular Formula | C21H25BrN6O |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-bromo-N-[4-[2-[3-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenyl]ethyl]phenyl]acetamide |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1cccc(CCc2ccc(NC(=O)CBr)cc2)c1 |
| InChI | InChI=1S/C21H25BrN6O/c1-21(2)27-19(23)26-20(24)28(21)17-5-3-4-15(12-17)7-6-14-8-10-16(11-9-14)25-18(29)13-22/h3-5,8-12H,6-7,13H2,1-2H3,(H,25,29)(H4,23,24,26,27) |
| InChIKey | BVGCPBHKSPQMCQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|