About 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene
1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene (PubChem CID 150686618) has the molecular formula C16H15NO3
and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene |
| PubChem CID | 150686618 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene |
| SMILES | Cc1cc(C2OCCc3ccccc32)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15NO3/c1-11-10-13(6-7-15(11)17(18)19)16-14-5-3-2-4-12(14)8-9-20-16/h2-7,10,16H,8-9H2,1H3 |
| InChIKey | JIZMVQKSTJBKJW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene?
The IUPAC name of 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene (CID 150686618) is 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene?
The canonical SMILES for 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene is Cc1cc(C2OCCc3ccccc32)ccc1[N+](=O)[O-].
What is the InChIKey of 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene?
The InChIKey is JIZMVQKSTJBKJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO3/c1-11-10-13(6-7-15(11)17(18)19)16-14-5-3-2-4-12(14)8-9-20-16/h2-7,10,16H,8-9H2,1H3.
What are the key properties of 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene?
1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene has a molecular weight of 269.30 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-4-nitrophenyl)-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 150686618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).