C16H19N5 — CID 150688579
3-cyclopentyl-3-[4-(5-methylpyrimidin-4-yl)pyrazol-1-yl]propanenitrile (PubChem CID 150688579) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-cyclopentyl-3-[4-(5-methylpyrimidin-4-yl)pyrazol-1-yl]propanenitrile.
| Compound Name | 3-cyclopentyl-3-[4-(5-methylpyrimidin-4-yl)pyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 150688579 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3-cyclopentyl-3-[4-(5-methylpyrimidin-4-yl)pyrazol-1-yl]propanenitrile |
| SMILES | Cc1cncnc1-c1cnn(C(CC#N)C2CCCC2)c1 |
| InChI | InChI=1S/C16H19N5/c1-12-8-18-11-19-16(12)14-9-20-21(10-14)15(6-7-17)13-4-2-3-5-13/h8-11,13,15H,2-6H2,1H3 |
| InChIKey | JJJWQNLMVFKGOD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |