C9H15N — CID 150690711
(1S)-2,3,3a,4,5,6-hexahydro-1H-inden-1-amine (PubChem CID 150690711) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (1S)-2,3,3a,4,5,6-hexahydro-1H-inden-1-amine.
| Compound Name | (1S)-2,3,3a,4,5,6-hexahydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 150690711 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (1S)-2,3,3a,4,5,6-hexahydro-1H-inden-1-amine |
| SMILES | N[C@H]1CCC2CCCC=C21 |
| InChI | InChI=1S/C9H15N/c10-9-6-5-7-3-1-2-4-8(7)9/h4,7,9H,1-3,5-6,10H2/t7?,9-/m0/s1 |
| InChIKey | MFLYJGGHNKOJJE-NETXQHHPSA-N |
| XLogP | 1.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|