About 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide
4-benzhydrylidene-N-methylpiperidine-1-carbothioamide (PubChem CID 15069115) has the molecular formula C20H22N2S
and a molecular weight of 322.48 g/mol. Its IUPAC name is 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide.
Molecular Properties
| Compound Name | 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide |
| PubChem CID | 15069115 |
| Molecular Formula | C20H22N2S |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide |
| SMILES | CNC(=S)N1CCC(=C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N2S/c1-21-20(23)22-14-12-18(13-15-22)19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11H,12-15H2,1H3,(H,21,23) |
| InChIKey | XZTUXRYOYIVKHZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide?
The IUPAC name of 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide (CID 15069115) is 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide.
What is the SMILES notation for 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide?
The canonical SMILES for 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide is CNC(=S)N1CCC(=C(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide?
The InChIKey is XZTUXRYOYIVKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2S/c1-21-20(23)22-14-12-18(13-15-22)19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11H,12-15H2,1H3,(H,21,23).
What are the key properties of 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide?
4-benzhydrylidene-N-methylpiperidine-1-carbothioamide has a molecular weight of 322.48 g/mol, XLogP of 4.09, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzhydrylidene-N-methylpiperidine-1-carbothioamide is sourced from PubChem (CID 15069115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).