C19H16F3N3O6S — CID 150692601
2-ethylsulfonyl-5-methoxy-N-[4-oxo-6-(trifluoromethoxy)quinazolin-3-yl]benzamide (PubChem CID 150692601) has the molecular formula C19H16F3N3O6S and a molecular weight of 471.41 g/mol. Its IUPAC name is 2-ethylsulfonyl-5-methoxy-N-[4-oxo-6-(trifluoromethoxy)quinazolin-3-yl]benzamide.
| Compound Name | 2-ethylsulfonyl-5-methoxy-N-[4-oxo-6-(trifluoromethoxy)quinazolin-3-yl]benzamide |
|---|---|
| PubChem CID | 150692601 |
| Molecular Formula | C19H16F3N3O6S |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-ethylsulfonyl-5-methoxy-N-[4-oxo-6-(trifluoromethoxy)quinazolin-3-yl]benzamide |
| SMILES | CCS(=O)(=O)c1ccc(OC)cc1C(=O)Nn1cnc2ccc(OC(F)(F)F)cc2c1=O |
| InChI | InChI=1S/C19H16F3N3O6S/c1-3-32(28,29)16-7-5-11(30-2)8-14(16)17(26)24-25-10-23-15-6-4-12(31-19(20,21)22)9-13(15)18(25)27/h4-10H,3H2,1-2H3,(H,24,26) |
| InChIKey | JKERIBFWEWGYIK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |