C30H34N4O3 — CID 15069336
2-[4-[[2-butyl-5-(butylcarbamoylamino)benzimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 15069336) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 2-[4-[[2-butyl-5-(butylcarbamoylamino)benzimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-butyl-5-(butylcarbamoylamino)benzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 15069336 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 2-[4-[[2-butyl-5-(butylcarbamoylamino)benzimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCNC(=O)Nc1ccc2c(c1)nc(CCCC)n2Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C30H34N4O3/c1-3-5-11-28-33-26-19-23(32-30(37)31-18-6-4-2)16-17-27(26)34(28)20-21-12-14-22(15-13-21)24-9-7-8-10-25(24)29(35)36/h7-10,12-17,19H,3-6,11,18,20H2,1-2H3,(H,35,36)(H2,31,32,37) |
| InChIKey | FCBLHBGXYMBEDE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|