C24H30F2N4O3S — CID 150696698
10-[4-[[2-(2,2-difluoroethoxy)-3-pyridinyl]amino]-5-methylthieno[2,3-d]pyrimidin-6-yl]decanoic acid (PubChem CID 150696698) has the molecular formula C24H30F2N4O3S and a molecular weight of 492.59 g/mol. Its IUPAC name is 10-[4-[[2-(2,2-difluoroethoxy)-3-pyridinyl]amino]-5-methylthieno[2,3-d]pyrimidin-6-yl]decanoic acid.
| Compound Name | 10-[4-[[2-(2,2-difluoroethoxy)-3-pyridinyl]amino]-5-methylthieno[2,3-d]pyrimidin-6-yl]decanoic acid |
|---|---|
| PubChem CID | 150696698 |
| Molecular Formula | C24H30F2N4O3S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 10-[4-[[2-(2,2-difluoroethoxy)-3-pyridinyl]amino]-5-methylthieno[2,3-d]pyrimidin-6-yl]decanoic acid |
| SMILES | Cc1c(CCCCCCCCCC(=O)O)sc2ncnc(Nc3cccnc3OCC(F)F)c12 |
| InChI | InChI=1S/C24H30F2N4O3S/c1-16-18(11-7-5-3-2-4-6-8-12-20(31)32)34-24-21(16)22(28-15-29-24)30-17-10-9-13-27-23(17)33-14-19(25)26/h9-10,13,15,19H,2-8,11-12,14H2,1H3,(H,31,32)(H,28,29,30) |
| InChIKey | JKZNLUXQGOTNQV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|