C22H37NO2 — CID 15069714
(2E,6E,10E)-N,N-diethyl-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienamide (PubChem CID 15069714) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is (2E,6E,10E)-N,N-diethyl-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienamide.
| Compound Name | (2E,6E,10E)-N,N-diethyl-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 15069714 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | (2E,6E,10E)-N,N-diethyl-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienamide |
| SMILES | CCN(CC)C(=O)/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C22H37NO2/c1-7-23(8-2)22(25)20(5)16-10-14-18(3)12-9-13-19(4)15-11-17-21(6)24/h12,15-16H,7-11,13-14,17H2,1-6H3/b18-12+,19-15+,20-16+ |
| InChIKey | PUXDYECSHBLCNP-IULDXAMZSA-N |
| XLogP | 5.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|