C18H16N2 — CID 150697172
(2,5-diphenylphenyl)hydrazine (PubChem CID 150697172) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (2,5-diphenylphenyl)hydrazine.
| Compound Name | (2,5-diphenylphenyl)hydrazine |
|---|---|
| PubChem CID | 150697172 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (2,5-diphenylphenyl)hydrazine |
| SMILES | NNc1cc(-c2ccccc2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C18H16N2/c19-20-18-13-16(14-7-3-1-4-8-14)11-12-17(18)15-9-5-2-6-10-15/h1-13,20H,19H2 |
| InChIKey | JLBYNTWEXXMAPK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|