About (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane
(2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane (PubChem CID 150697284) has the molecular formula C10H13N3Si
and a molecular weight of 203.32 g/mol. Its IUPAC name is (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane.
Molecular Properties
| Compound Name | (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane |
| PubChem CID | 150697284 |
| Molecular Formula | C10H13N3Si |
| Molecular Weight | 203.32 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane |
| SMILES | Cc1ccccc1C[SiH2]n1cncn1 |
| InChI | InChI=1S/C10H13N3Si/c1-9-4-2-3-5-10(9)6-14-13-8-11-7-12-13/h2-5,7-8H,6,14H2,1H3 |
| InChIKey | JLCMWIDEWIMEDK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane?
The IUPAC name of (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane (CID 150697284) is (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane.
What is the SMILES notation for (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane?
The canonical SMILES for (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane is Cc1ccccc1C[SiH2]n1cncn1.
What is the InChIKey of (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane?
The InChIKey is JLCMWIDEWIMEDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3Si/c1-9-4-2-3-5-10(9)6-14-13-8-11-7-12-13/h2-5,7-8H,6,14H2,1H3.
What are the key properties of (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane?
(2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane has a molecular weight of 203.32 g/mol, XLogP of 0.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)methyl-(1,2,4-triazol-1-yl)silane is sourced from PubChem (CID 150697284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).