C20H33NO2 — CID 15069742
N-[(2E,6E,10E)-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl]acetamide (PubChem CID 15069742) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is N-[(2E,6E,10E)-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl]acetamide.
| Compound Name | N-[(2E,6E,10E)-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl]acetamide |
|---|---|
| PubChem CID | 15069742 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | N-[(2E,6E,10E)-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl]acetamide |
| SMILES | CC(=O)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CNC(C)=O |
| InChI | InChI=1S/C20H33NO2/c1-16(11-7-13-18(3)15-21-20(5)23)9-6-10-17(2)12-8-14-19(4)22/h9,12-13H,6-8,10-11,14-15H2,1-5H3,(H,21,23)/b16-9+,17-12+,18-13+ |
| InChIKey | AAIWFXRPEZKBRX-KJACOYNYSA-N |
| XLogP | 4.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|