C23H39NO3 — CID 15069757
ethyl (2E,6E,10E)-12-[di(propan-2-yl)amino]-3,7,11-trimethyl-12-oxododeca-2,6,10-trienoate (PubChem CID 15069757) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is ethyl (2E,6E,10E)-12-[di(propan-2-yl)amino]-3,7,11-trimethyl-12-oxododeca-2,6,10-trienoate.
| Compound Name | ethyl (2E,6E,10E)-12-[di(propan-2-yl)amino]-3,7,11-trimethyl-12-oxododeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 15069757 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | ethyl (2E,6E,10E)-12-[di(propan-2-yl)amino]-3,7,11-trimethyl-12-oxododeca-2,6,10-trienoate |
| SMILES | CCOC(=O)/C=C(\C)CC/C=C(\C)CC/C=C(\C)C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C23H39NO3/c1-9-27-22(25)16-20(7)14-10-12-19(6)13-11-15-21(8)23(26)24(17(2)3)18(4)5/h12,15-18H,9-11,13-14H2,1-8H3/b19-12+,20-16+,21-15+ |
| InChIKey | UKEQZYOHPQEIDD-MQKPGIJDSA-N |
| XLogP | 5.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|