C10H12F3N3O2S — CID 150698632
3,3,3-trifluoro-N-(5-morpholin-4-yl-1,3-thiazol-2-yl)propanamide (PubChem CID 150698632) has the molecular formula C10H12F3N3O2S and a molecular weight of 295.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(5-morpholin-4-yl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(5-morpholin-4-yl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 150698632 |
| Molecular Formula | C10H12F3N3O2S |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3,3,3-trifluoro-N-(5-morpholin-4-yl-1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CC(F)(F)F)Nc1ncc(N2CCOCC2)s1 |
| InChI | InChI=1S/C10H12F3N3O2S/c11-10(12,13)5-7(17)15-9-14-6-8(19-9)16-1-3-18-4-2-16/h6H,1-5H2,(H,14,15,17) |
| InChIKey | JLJUDGXLWDIAER-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |