C11H9FN2OS — CID 150699383
N-(4-fluoro-2-methylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 150699383) has the molecular formula C11H9FN2OS and a molecular weight of 236.27 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-fluoro-2-methylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 150699383 |
| Molecular Formula | C11H9FN2OS |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cc(F)ccc1NC(=O)c1cncs1 |
| InChI | InChI=1S/C11H9FN2OS/c1-7-4-8(12)2-3-9(7)14-11(15)10-5-13-6-16-10/h2-6H,1H3,(H,14,15) |
| InChIKey | JLNUXPOHLHMEND-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |