C11H12F5NO — CID 15070169
4-methyl-3-(2,2,3,3,3-pentafluoropropoxymethyl)aniline (PubChem CID 15070169) has the molecular formula C11H12F5NO and a molecular weight of 269.21 g/mol. Its IUPAC name is 4-methyl-3-(2,2,3,3,3-pentafluoropropoxymethyl)aniline.
| Compound Name | 4-methyl-3-(2,2,3,3,3-pentafluoropropoxymethyl)aniline |
|---|---|
| PubChem CID | 15070169 |
| Molecular Formula | C11H12F5NO |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-methyl-3-(2,2,3,3,3-pentafluoropropoxymethyl)aniline |
| SMILES | Cc1ccc(N)cc1COCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H12F5NO/c1-7-2-3-9(17)4-8(7)5-18-6-10(12,13)11(14,15)16/h2-4H,5-6,17H2,1H3 |
| InChIKey | HDVYEESNLFTEDT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|