C31H27N3S — CID 150701890
2-[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4,5-triphenylthiophene (PubChem CID 150701890) has the molecular formula C31H27N3S and a molecular weight of 473.65 g/mol. Its IUPAC name is 2-[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4,5-triphenylthiophene.
| Compound Name | 2-[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4,5-triphenylthiophene |
|---|---|
| PubChem CID | 150701890 |
| Molecular Formula | C31H27N3S |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4,5-triphenylthiophene |
| SMILES | CS1(C)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccc(CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C31H27N3S/c1-35(2)30(26-16-10-5-11-17-26)28(24-12-6-3-7-13-24)29(25-14-8-4-9-15-25)31(35)27-20-18-23(19-21-27)22-33-34-32/h3-21H,22H2,1-2H3 |
| InChIKey | JMBFPUQVIYJWCQ-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|