C22H29NO2 — CID 150702826
methyl 2-[3-[[(4-tert-butylphenyl)methylamino]methyl]phenyl]propanoate (PubChem CID 150702826) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is methyl 2-[3-[[(4-tert-butylphenyl)methylamino]methyl]phenyl]propanoate.
| Compound Name | methyl 2-[3-[[(4-tert-butylphenyl)methylamino]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 150702826 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | methyl 2-[3-[[(4-tert-butylphenyl)methylamino]methyl]phenyl]propanoate |
| SMILES | COC(=O)C(C)c1cccc(CNCc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C22H29NO2/c1-16(21(24)25-5)19-8-6-7-18(13-19)15-23-14-17-9-11-20(12-10-17)22(2,3)4/h6-13,16,23H,14-15H2,1-5H3 |
| InChIKey | JMFWHDLIFDBKKU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |