C11H12F9I — CID 150705275
1-iodo-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cycloheptane (PubChem CID 150705275) has the molecular formula C11H12F9I and a molecular weight of 442.10 g/mol. Its IUPAC name is 1-iodo-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cycloheptane.
| Compound Name | 1-iodo-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cycloheptane |
|---|---|
| PubChem CID | 150705275 |
| Molecular Formula | C11H12F9I |
| Molecular Weight | 442.10 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 1-iodo-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cycloheptane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CCCCCC1I |
| InChI | InChI=1S/C11H12F9I/c12-8(13,6-4-2-1-3-5-7(6)21)9(14,15)10(16,17)11(18,19)20/h6-7H,1-5H2 |
| InChIKey | JMSOSNVIZWMRQX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.10 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|