C44H48SiZr — CID 150708646
bis(2-cyclohexyl-4-phenyl-1H-inden-1-ide);dimethylsilylidenezirconium(2+) (PubChem CID 150708646) has the molecular formula C44H48SiZr and a molecular weight of 696.18 g/mol. Its IUPAC name is bis(2-cyclohexyl-4-phenyl-1H-inden-1-ide);dimethylsilylidenezirconium(2+).
| Compound Name | bis(2-cyclohexyl-4-phenyl-1H-inden-1-ide);dimethylsilylidenezirconium(2+) |
|---|---|
| PubChem CID | 150708646 |
| Molecular Formula | C44H48SiZr |
| Molecular Weight | 696.18 g/mol |
| Exact Mass | 694.26 |
| IUPAC Name | bis(2-cyclohexyl-4-phenyl-1H-inden-1-ide);dimethylsilylidenezirconium(2+) |
| SMILES | C[Si](C)=[Zr+2].c1ccc(-c2cccc3[cH-]c(C4CCCCC4)cc23)cc1.c1ccc(-c2cccc3[cH-]c(C4CCCCC4)cc23)cc1 |
| InChI | InChI=1S/2C21H21.C2H6Si.Zr/c2*1-3-8-16(9-4-1)19-14-18-12-7-13-20(21(18)15-19)17-10-5-2-6-11-17;1-3-2;/h2*2,5-7,10-16H,1,3-4,8-9H2;1-2H3;/q2*-1;;+2 |
| InChIKey | CZRSLNYTTOMVOD-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.18 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|