About 6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene
6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene (PubChem CID 15071045) has the molecular formula C12H18O
and a molecular weight of 178.28 g/mol. Its IUPAC name is 6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene.
Analyze 6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene?
The IUPAC name of 6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene (CID 15071045) is 6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene.
What is the SMILES notation for 6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene?
The canonical SMILES for 6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene is COC1=CC2=CCCCC2(C)CC1.
What is the InChIKey of 6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene?
The InChIKey is OKKPPEJFQXQLCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-12-7-4-3-5-10(12)9-11(13-2)6-8-12/h5,9H,3-4,6-8H2,1-2H3.
What are the key properties of 6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene?
6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene has a molecular weight of 178.28 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-8a-methyl-2,3,7,8-tetrahydro-1H-naphthalene is sourced from PubChem (CID 15071045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).