C24H33F9O9S3 — CID 150713142
[2,3-bis(6,6,6-trifluorohexylsulfonyloxy)phenyl] 6,6,6-trifluorohexane-1-sulfonate (PubChem CID 150713142) has the molecular formula C24H33F9O9S3 and a molecular weight of 732.70 g/mol. Its IUPAC name is [2,3-bis(6,6,6-trifluorohexylsulfonyloxy)phenyl] 6,6,6-trifluorohexane-1-sulfonate.
| Compound Name | [2,3-bis(6,6,6-trifluorohexylsulfonyloxy)phenyl] 6,6,6-trifluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 150713142 |
| Molecular Formula | C24H33F9O9S3 |
| Molecular Weight | 732.70 g/mol |
| Exact Mass | 732.11 |
| IUPAC Name | [2,3-bis(6,6,6-trifluorohexylsulfonyloxy)phenyl] 6,6,6-trifluorohexane-1-sulfonate |
| SMILES | O=S(=O)(CCCCCC(F)(F)F)Oc1cccc(OS(=O)(=O)CCCCCC(F)(F)F)c1OS(=O)(=O)CCCCCC(F)(F)F |
| InChI | InChI=1S/C24H33F9O9S3/c25-22(26,27)13-4-1-7-16-43(34,35)40-19-11-10-12-20(41-44(36,37)17-8-2-5-14-23(28,29)30)21(19)42-45(38,39)18-9-3-6-15-24(31,32)33/h10-12H,1-9,13-18H2 |
| InChIKey | JOHZORBWJGIOAM-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|