C9H12O5 — CID 15071406
(3aS,4S,6aS)-4-hydroxy-6,6a-bis(hydroxymethyl)-3a,4-dihydro-3H-cyclopenta[b]furan-2-one (PubChem CID 15071406) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (3aS,4S,6aS)-4-hydroxy-6,6a-bis(hydroxymethyl)-3a,4-dihydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3aS,4S,6aS)-4-hydroxy-6,6a-bis(hydroxymethyl)-3a,4-dihydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 15071406 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (3aS,4S,6aS)-4-hydroxy-6,6a-bis(hydroxymethyl)-3a,4-dihydro-3H-cyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@H]2[C@@H](O)C=C(CO)[C@@]2(CO)O1 |
| InChI | InChI=1S/C9H12O5/c10-3-5-1-7(12)6-2-8(13)14-9(5,6)4-11/h1,6-7,10-12H,2-4H2/t6-,7-,9+/m0/s1 |
| InChIKey | GXMPAYJMNREZKW-ACLDMZEESA-N |
| XLogP | -1.43 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|