C10H17NO — CID 15071617
(2S,4R)-2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol (PubChem CID 15071617) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (2S,4R)-2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol.
| Compound Name | (2S,4R)-2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 15071617 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2S,4R)-2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol |
| SMILES | C/C=C/C=C/[C@@H]1C[C@H](O)CCN1 |
| InChI | InChI=1S/C10H17NO/c1-2-3-4-5-9-8-10(12)6-7-11-9/h2-5,9-12H,6-8H2,1H3/b3-2+,5-4+/t9-,10-/m1/s1 |
| InChIKey | HUJDEHIXVKEMDT-RQBJNGEXSA-N |
| XLogP | 1.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|